TAF1 transcriptional regulatory sub-network
The possible genes regulated by the transcription factor were obtained by calculation, and the results were displayed in the form of network
NETWORK ID: CN2435
In order to ensure the specificity of data, an ID index is built by the database itself, and each result corresponds to an ID.
CONDITION: sertraline
| ID | BRD-K82036761 |
| name | sertraline |
| type | Small molecule |
| molecular formula | C17H17Cl2N |
| molecular weight | 306.2 |
| condition dose | 10 uM |
| condition time | 6 h |
| smiles | CN[C@H]1CC[C@@H](c2ccc(Cl)c(Cl)c2)c2ccccc12 |
CONDITION TYPE: trt_cp
Compound
CELL LINE: MCF7
Cell lines used for experiments
TRANSCRIPTION FACTOR: TAF1
Transcription regulatory factors corresponding to this network
ARTICLE: sertraline
[1] Clinical pharmacokinetics of sertraline.
[2] Sertraline versus other antidepressive agents for depression.
[3] Using sertraline in postpartum and breastfeeding: balancing risks and benefits.
[4] Physical exercise for late-life major depression.
[5] Sertraline treatment of major depression in patients with acute MI or unstable angina.
[7] Physical exercise for late-life depression: Effects on symptom dimensions and time course.
Curated target protein/gene of this condition/drug
Protein target or gene target of this condition curated by previous studies and their associated KEGG pathways are shown below
| Target Gene | KEGG pathway |
|
SLC6A3 |
hsa04721 
|
|
SLC6A4 
|
Differential expressed genes in this transcriptional regulatory sub-network
| logfc | > 0.45 and P < = 1e-5. If you want to view or download the data, you can click [expand]
| Symbol | control | control | control | condition | condition | condition | condition | condition | condition |
|---|---|---|---|---|---|---|---|---|---|
| IL16 | 5.8427 | 6.3944 | 6.3925 | 5.4009 | 5.2708 | 4.8769 | 4.872 | 5.8545 | 5.0528 |
| EPB42 | 4.8267 | 5.2879 | 5.2879 | 3.9541 | 4.5927 | 4.3524 | 4.2767 | 4.1946 | 4.3824 |
| AHSP | 5.8533 | 6.15 | 6.15 | 4.3744 | 5.1092 | 5.2738 | 5.1908 | 5.2066 | 5.3014 |
| NSUN6 | 6.3126 | 6.0039 | 6.003 | 5.1828 | 5.1643 | 5.174 | 5.0356 | 5.1247 | 6.0761 |
| TJP3 | 8.0655 | 8.0992 | 8.1021 | 7.7132 | 7.1941 | 7.452 | 7.4572 | 6.6424 | 6.9114 |
| CCND1 | 8.5674 | 8.4109 | 8.4111 | 7.2503 | 7.5833 | 7.561 | 7.5506 | 5.9501 | 5.906 |
| TP53 | 11.16 | 10.672 | 10.6691 | 10.6575 | 8.4269 | 9.5132 | 9.5153 | 9.5036 | 9.3947 |
| MUC1 | 6.1678 | 7.0329 | 7.0334 | 5.7959 | 5.8935 | 5.8749 | 5.8498 | 4.9453 | 4.8251 |
| CDC42 | 12.1348 | 12.2811 | 12.2842 | 11.8577 | 10.4354 | 10.3447 | 10.3486 | 9.4168 | 9.9282 |
| COG4 | 9.1082 | 8.6012 | 8.5995 | 8.434 | 8.1765 | 7.8084 | 7.8086 | 8.0811 | 7.8735 |
| CSK | 10.9937 | 10.7245 | 10.7265 | 10.5574 | 9.8134 | 9.674 | 9.67 | 9.5697 | 9.7613 |
| CCDC85B | 10.0775 | 10.0698 | 10.0689 | 9.7629 | 8.8924 | 9.0028 | 9.0002 | 9.284 | 9.3789 |
| DHRS7 | 9.3416 | 9.6025 | 9.6025 | 8.5274 | 8.6782 | 8.7232 | 8.7146 | 8.9626 | 8.8116 |
| BAD | 10.112 | 11.885 | 11.885 | 10.2397 | 9.6328 | 10.0836 | 10.0775 | 8.9422 | 9.9566 |
| HEATR1 | 10.081 | 10.1271 | 10.1245 | 8.8381 | 9.1607 | 8.8417 | 8.8448 | 7.5163 | 8.7724 |
| PXMP2 | 12.6771 | 11.5888 | 11.5888 | 10.1158 | 9.6145 | 8.9942 | 8.9898 | 8.444 | 9.6783 |
| NGRN | 10.4689 | 6.7469 | 6.748 | 5.2201 | 6.4023 | 5.7231 | 5.6994 | 5.3908 | 5.899 |
| KLHL21 | 4.8629 | 8.9017 | 8.9017 | 4.5742 | 4.2178 | 3.7158 | 3.6965 | 4.039 | 3.9704 |
| CIAPIN1 | 8.4328 | 9.0506 | 9.0506 | 7.8589 | 8.4609 | 7.4022 | 7.3915 | 6.5147 | 7.8257 |
| SRRM1 | 11.4085 | 10.8054 | 10.8048 | 10.5819 | 10.672 | 10.2414 | 10.1826 | 9.9047 | 10.0522 |
| ERLIN1 | 8.9985 | 8.8969 | 8.8974 | 8.5493 | 8.0636 | 7.8362 | 7.6427 | 8.1915 | 7.0703 |
| YBX3 | 14.2176 | 13.6317 | 13.6317 | 13.6269 | 12.4537 | 12.9209 | 12.9444 | 13.1585 | 12.8035 |
| DHPS | 9.3636 | 9.152 | 9.1511 | 8.7066 | 8.8979 | 8.4618 | 8.5847 | 8.6485 | 8.5026 |
| ANAPC5 | 11.4744 | 11.5644 | 11.5644 | 10.8168 | 10.6508 | 10.4143 | 10.2898 | 9.7181 | 9.7716 |
| LITAF | 9.2054 | 10.1222 | 10.1198 | 8.8448 | 8.1036 | 7.2199 | 7.0297 | 7.048 | 7.0205 |
| GOT2 | 12.1628 | 12.2042 | 12.2042 | 10.691 | 10.6532 | 11.0201 | 11.025 | 11.8577 | 11.9562 |
| CAPRIN1 | 8.3014 | 7.6315 | 7.6315 | 6.0379 | 6.9781 | 6.9342 | 6.9702 | 5.3851 | 6.6489 |
| RERE | 7.8778 | 7.903 | 7.902 | 6.8227 | 7.1586 | 7.4465 | 7.2898 | 7.5128 | 7.2205 |
| RAD23A | 11.7412 | 11.947 | 11.9447 | 10.9085 | 11.1881 | 11.0854 | 11.0192 | 11.7436 | 10.9784 |
| ECHS1 | 12.4459 | 12.0629 | 12.0629 | 11.6179 | 11.1453 | 11.1843 | 11.1304 | 11.1272 | 10.3986 |
| PUM1 | 9.6437 | 9.7773 | 9.7777 | 8.9783 | 9.1974 | 9.251 | 9.2226 | 9.1171 | 8.5704 |
| HDAC1 | 11.1191 | 10.9242 | 10.9251 | 10.0845 | 10.062 | 10.6011 | 10.6564 | 9.562 | 10.0757 |
| ERP29 | 12.133 | 13.1351 | 13.1351 | 11.767 | 11.8868 | 11.0468 | 11.0793 | 9.1971 | 9.8436 |
| NQO1 | 13.486 | 12.8817 | 12.8817 | 12.3796 | 10.7786 | 11.9696 | 11.9219 | 11.1287 | 10.6831 |
| CNN2 | 7.9134 | 8.2083 | 8.2075 | 6.8948 | 6.6659 | 7.5792 | 7.5467 | 7.4148 | 6.3808 |
| EIF2B1 | 9.6198 | 9.3113 | 9.3119 | 9.0615 | 8.9444 | 8.7537 | 8.7492 | 8.2567 | 8.3762 |
| DCAF11 | 8.4597 | 8.1076 | 8.1076 | 7.9168 | 7.8348 | 7.1672 | 7.1257 | 6.8523 | 7.3243 |
| CIB1 | 9.455 | 8.7146 | 8.7155 | 8.4173 | 8.5512 | 7.8782 | 7.9034 | 7.4755 | 7.6265 |
| GOLGA3 | 8.0478 | 8.728 | 8.7266 | 8.2835 | 7.5365 | 7.2214 | 7.3406 | 6.1122 | 6.9174 |
| PRKCZ | 7.8868 | 6.9818 | 6.9792 | 6.389 | 4.794 | 5.8957 | 5.8449 | 4.0866 | 4.4372 |
| PARP4 | 8.1252 | 9.0249 | 9.0245 | 8.5162 | 7.627 | 7.5585 | 7.4567 | 6.595 | 7.6498 |
| LAMC2 | 2.2976 | 3.0699 | 3.0699 | 2.2129 | 1.9328 | 0.6419 | 0.7641 | 1.7758 | 1.601 |
| UNC119B | 8.7575 | 9.4657 | 9.4657 | 8.0643 | 8.7072 | 8.1992 | 8.2303 | 7.261 | 8.646 |
| MAP2K2 | 10.5777 | 10.3687 | 10.371 | 9.8722 | 8.798 | 9.7329 | 9.7257 | 8.721 | 9.4993 |
| MLXIP | 7.6281 | 7.6505 | 7.6475 | 6.3027 | 6.8017 | 6.6742 | 6.786 | 6.3308 | 7.2623 |
| GSTM3 | 10.002 | 9.0112 | 9.0151 | 7.5859 | 7.7283 | 8.4128 | 8.3775 | 5.259 | 7.0812 |
| CTPS1 | 9.1697 | 9.2291 | 9.2291 | 8.3056 | 8.8299 | 7.4891 | 7.3894 | 8.436 | 7.4144 |
| ATXN2 | 9.3822 | 9.1693 | 9.1699 | 9.1194 | 8.7003 | 8.3931 | 8.2448 | 7.9087 | 7.9724 |
| SFSWAP | 8.4653 | 9.0076 | 9.0069 | 8.4088 | 8.4006 | 7.897 | 7.8657 | 7.703 | 7.9282 |
| SPINT1 | 9.3119 | 8.5232 | 8.5251 | 7.7763 | 8.2762 | 8.0613 | 8.0883 | 8.0525 | 7.9549 |
| RNASEH2A | 10.9795 | 10.7471 | 10.7485 | 9.9939 | 10.4647 | 10.0487 | 10.0729 | 9.3119 | 9.6284 |
| CYBA | 7.8031 | 7.0227 | 7.0221 | 6.0899 | 6.4661 | 3.7918 | 3.8832 | 4.09 | 3.0033 |
| KRR1 | 7.6151 | 7.3503 | 7.3514 | 6.9686 | 7.1963 | 6.1466 | 6.2237 | 6.4435 | 6.017 |
| RBBP8 | 11.3191 | 11.2105 | 11.2108 | 10.1659 | 10.8378 | 9.7198 | 9.8413 | 10.8009 | 9.0051 |
| MED1 | 7.6971 | 7.4487 | 7.444 | 7.12 | 6.349 | 6.3951 | 6.5832 | 7.1943 | 6.9671 |
| SULT1A1 | 8.4173 | 8.3165 | 8.3149 | 7.5067 | 8.0749 | 7.7629 | 7.6605 | 7.4664 | 7.2094 |
| PITPNM1 | 7.8144 | 8.2343 | 8.2347 | 7.7987 | 7.2152 | 7.3942 | 7.4241 | 6.6258 | 6.8163 |
| LCMT2 | 7.1781 | 6.9683 | 6.9702 | 6.6859 | 6.7024 | 6.1495 | 6.2414 | 6.1767 | 6.4452 |
| ZNF140 | 8.377 | 8.5748 | 8.5748 | 7.4902 | 7.6605 | 7.7657 | 7.6971 | 7.5334 | 8.4662 |
| SMAD7 | 5.7615 | 6.2323 | 6.2304 | 5.4368 | 5.4105 | 5.3554 | 5.3859 | 4.7215 | 5.2751 |
| GCHFR | 7.3296 | 8.127 | 8.1274 | 7.3334 | 6.9048 | 6.5441 | 6.7232 | 7.0431 | 6.7503 |
| SNTB2 | 8.7068 | 9.0177 | 9.0203 | 7.3915 | 7.9204 | 7.7428 | 7.8523 | 8.0305 | 7.9891 |
| PEBP1 | 12.969 | 13.3854 | 13.3772 | 11.9403 | 11.727 | 10.8755 | 10.7485 | 9.4211 | 8.3491 |
| SLC4A1 | 4.6401 | 4.7889 | 4.7876 | 3.6328 | 2.8508 | 2.9999 | 2.7176 | 3.5898 | 4.0608 |
| MPPE1 | 6.3786 | 5.7641 | 5.7639 | 5.7008 | 5.5247 | 5 | 4.9454 | 4.7923 | 4.9564 |
| C4BPB | 5.9459 | 6.275 | 6.2747 | 4.8565 | 5.8611 | 4.909 | 4.9661 | 4.867 | 4.6255 |
| CRYAB | 6.1363 | 5.9167 | 5.9119 | 4.0715 | 4.6262 | 5.0535 | 4.9904 | 5.4632 | 5.6112 |
| SLC9A1 | 6.843 | 7.4628 | 7.4628 | 6.98 | 6.5431 | 6.3259 | 6.3401 | 5.5783 | 5.92 |
| KRT16 | 5.5739 | 6.6435 | 6.6432 | 5.2865 | 5.0479 | 5.6856 | 5.6782 | 4.7501 | 5.4476 |
| HECTD4 | 6.0428 | 5.9053 | 5.9042 | 5.5744 | 5.6624 | 5.2028 | 5.171 | 4.9836 | 4.7272 |
| SULT1A2 | 7.6821 | 7.5108 | 7.5099 | 6.1832 | 7.3881 | 6.6531 | 6.6191 | 6.1953 | 6.5083 |
| ATXN7L3B | 11.5242 | 11.404 | 11.404 | 10.6351 | 9.9948 | 10.5879 | 10.6459 | 8.585 | 9.6665 |
| EP400 | 7.0262 | 6.7804 | 6.7798 | 6.4363 | 6.4289 | 5.7738 | 5.7074 | 5.1825 | 5.6534 |
| MRPS31 | 10.1886 | 10.2748 | 10.2757 | 9.2625 | 9.5888 | 9.6536 | 9.6605 | 9.4913 | 9.9617 |
| LRRC47 | 10.7965 | 11.3344 | 11.3344 | 10.5181 | 10.1779 | 9.8712 | 9.8207 | 10.9216 | 10.4708 |
| DNAJC16 | 7.1631 | 7.2954 | 7.2944 | 6.2819 | 6.628 | 6.3537 | 6.4175 | 5.9724 | 6.0362 |
| VWA8 | 6.4552 | 6.6965 | 6.6965 | 6.3674 | 5.9455 | 5.3 | 5.2607 | 5.4381 | 4.945 |
| POLE | 8.5688 | 8.6304 | 8.6309 | 8.2264 | 7.5128 | 7.5632 | 7.4991 | 7.6784 | 8.1042 |
| FARSA | 10.0601 | 10.1812 | 10.1797 | 8.8916 | 9.5896 | 9.2229 | 9.3019 | 9.9015 | 9.5309 |
| ALDH18A1 | 6.2089 | 6.1071 | 6.1065 | 5.3231 | 5.838 | 4.762 | 4.7197 | 5.0002 | 4.11 |
| CNOT2 | 10.1149 | 10.216 | 10.2179 | 9.1851 | 9.8057 | 9.3933 | 9.4015 | 9.2886 | 9.4044 |
| AKIRIN1 | 8.8042 | 8.6888 | 8.6884 | 8.2252 | 7.7396 | 7.5349 | 7.4283 | 8.0161 | 6.3562 |
| VPS4A | 10.3036 | 10.7666 | 10.7652 | 9.9954 | 9.9394 | 9.7784 | 9.7881 | 10.0639 | 9.9059 |
| CCNB1IP1 | 9.9939 | 10.4805 | 10.4805 | 9.5551 | 8.937 | 9.2701 | 9.2529 | 8.9932 | 9.5291 |
| ARL6IP4 | 12.6023 | 11.8859 | 11.8859 | 11.6104 | 11.4642 | 10.806 | 10.8013 | 11.5277 | 10.3533 |
| SLC25A10 | 9.1395 | 9.0837 | 9.0848 | 7.9588 | 8.7109 | 8.4529 | 8.4621 | 8.4823 | 8.6824 |
| PROSER1 | 9.1037 | 8.9007 | 8.9009 | 8.2198 | 8.5277 | 8.3174 | 8.267 | 7.6557 | 8.441 |
| LEMD3 | 7.9396 | 7.9555 | 7.9555 | 7.0262 | 7.1376 | 6.966 | 7.0028 | 7.4568 | 7.411 |
| SLC25A15 | 8.7985 | 8.4959 | 8.4964 | 7.3319 | 8.379 | 6.799 | 6.7027 | 6.2283 | 7.6439 |
| FHL3 | 6.1833 | 5.7908 | 5.7919 | 5.6776 | 5.3025 | 4.4937 | 4.4551 | 4.9086 | 4.5355 |
| MLYCD | 7.8711 | 7.9092 | 7.911 | 7.2586 | 7.223 | 7.135 | 7.243 | 7.2903 | 6.7146 |
| C12orf43 | 8.5435 | 8.7699 | 8.7709 | 8.1654 | 7.7699 | 7.7889 | 7.8131 | 8.3355 | 7.6157 |
| ZBTB7A | 9.683 | 9.5475 | 9.5475 | 9.29 | 8.0765 | 8.8611 | 8.9055 | 7.6618 | 8.5427 |
| RHCG | 4.3021 | 5.351 | 5.3489 | 4.5577 | 3.6661 | 3.7 | 3.7034 | 4.1711 | 4.2622 |
| LTBP3 | 8.1165 | 7.8741 | 7.8761 | 7.6636 | 6.7925 | 4.3084 | 4.4054 | 5.001 | 3.7939 |
| CSDE1 | 11.8185 | 11.6729 | 11.6729 | 10.7563 | 11.1332 | 10.8452 | 10.8755 | 10.3143 | 10.9639 |
| TNPO2 | 9.2012 | 10.3461 | 10.3471 | 8.7977 | 8.8775 | 9.1398 | 9.0531 | 8.1149 | 8.4695 |
| DENR | 11.3283 | 11.1843 | 11.1859 | 10.9893 | 10.3831 | 9.9904 | 9.8712 | 9.3379 | 9.8582 |
| ALDH6A1 | 8.837 | 8.5869 | 8.5866 | 7.1526 | 6.9165 | 8.0599 | 8.2633 | 6.5884 | 5.8776 |
| WASF2 | 9.0341 | 9.2441 | 9.2454 | 7.9485 | 8.5604 | 7.9869 | 7.9655 | 8.7126 | 8.5737 |
| SEH1L | 10.7597 | 10.256 | 10.2505 | 9.2107 | 9.5902 | 9.7546 | 9.7703 | 8.9391 | 9.0864 |
| DCLRE1C | 6.9771 | 6.1627 | 6.1623 | 5.5182 | 6.0421 | 5.4368 | 5.419 | 4.2897 | 4.7918 |
| PRDX2 | 10.3053 | 12.5448 | 12.5448 | 8.7492 | 10.4716 | 9.6511 | 9.724 | 8.7434 | 10.1198 |
| MTA2 | 6.6843 | 5.7784 | 5.7783 | 5.3994 | 5.2251 | 5.2032 | 5.183 | 5.0717 | 5.3611 |
| ACAN | 6.3548 | 5.6038 | 5.6048 | 4.8333 | 4.7419 | 4.2724 | 4.2523 | 4.831 | 5.5865 |
| SAA4 | 5.0587 | 5.8443 | 5.8457 | 4.259 | 5.2394 | 4.5089 | 4.4435 | 4.6208 | 5.0119 |
TAF1 transcriptional regulatory sub-network
The possible genes regulated by the transcription factor were obtained by calculation, and the results were displayed in the form of network
ARTICLE: TAF1
[1] TAF1 plays a critical role in AML1-ETO driven leukemogenesis.
[2] Missense variants in TAF1 and developmental phenotypes: challenges of determining pathogenicity.
[4] TAF1-gene editing alters the morphology and function of the cerebellum and cerebral cortex.
[6] TAF1 Transcripts and Neurofilament Light Chain as Biomarkers for X-linked Dystonia-Parkinsonism.
[8] Dual Inhibition of TAF1 and BET Bromodomains from the BI-2536 Kinase Inhibitor Scaffold.
[9] Neuronal-specific microexon splicing of TAF1 mRNA is directly regulated by SRRM4/nSR100.
Transcription factor KEGG
The KEGG pathway of the TF in this TRN is shown below