The possible genes regulated by the transcription factor were obtained by calculation, and the results were displayed in the form of network
In order to ensure the specificity of data, an ID index is built by the database itself, and each result corresponds to an ID.
ID | BRD-K55468218 |
name | spiperone |
type | Small molecule |
molecular formula | C23H26FN3O2 |
molecular weight | 395.5 |
condition dose | 10 uM |
condition time | 24 h |
smiles | Fc1ccc(cc1)C(=O)CCCN1CCC2(CC1)N(CNC2=O)c1ccccc1 |
Compound
Cell lines used for experiments
Transcription regulatory factors corresponding to this network
[1] Levodopa inhibits the development of lens-induced myopia in chicks.
[3] Spiperone: Tritium labelling at high specific activity.
[4] Structure of the dopamine D(2) receptor in complex with the antipsychotic drug spiperone.
[5] Distinct Dopamine D₂ Receptor Antagonists Differentially Impact D₂ Receptor Oligomerization.
[7] Ketanserin and spiperone as templates for novel serotonin 5-HT(2A) antagonists.
[9] 125I-Spiperone: a novel ligand for D2 dopamine receptors.
Protein target or gene target of this condition curated by previous studies and their associated KEGG pathways are shown below
Target Gene | KEGG pathway |
ADRA1A |
hsa04152 |
ADRA1B |
hsa04970 |
ADRA1D |
hsa04970 |
DRD1 |
hsa04080 |
DRD2 |
hsa05012 |
DRD3 |
|
DRD4 |
|
DRD5 |
hsa04728 |
HTR1A |
hsa04080 |
HTR1D |
hsa04742 |
HTR2A |
hsa04540 |
HTR2B |
hsa04750 |
HTR2C |
hsa04726 |
HTR6 |
|
HTR7 |
hsa04080 |
| logfc | > 0.45 and P < = 1e-5. If you want to view or download the data, you can click [expand]
Symbol | control | control | control | condition | condition | condition |
---|---|---|---|---|---|---|
FAM169A | 8.4379 | 9.1171 | 8.4463 | 6.94 | 6.7535 | 7.0206 |
VASH2 | 6.0307 | 5.5989 | 5.5999 | 4.179 | 4.1054 | 4.4684 |
PROS1 | 9.3287 | 9.3491 | 9.4952 | 5.1828 | 4.7603 | 5.1003 |
CDK4 | 12.8082 | 12.9604 | 13.353 | 9.1753 | 10.3914 | 10.7191 |
AURKB | 11.0783 | 10.5393 | 11.3085 | 8.4509 | 8.1853 | 8.4444 |
AURKA | 7.9629 | 7.9432 | 8.0641 | 5.7957 | 5.2655 | 6.2464 |
HMGA2 | 11.3612 | 11.4517 | 11.5089 | 8.4324 | 8.6892 | 8.6731 |
ERBB3 | 10.1175 | 9.3329 | 9.6808 | 7.1418 | 6.3435 | 5.9736 |
TFDP1 | 9.5679 | 10.3283 | 10.4459 | 8.216 | 7.8494 | 8.1396 |
PCNA | 14.5819 | 14.5624 | 14.6943 | 13.0044 | 13.1639 | 13.2319 |
PFKL | 9.1958 | 8.5241 | 9.1478 | 7.3196 | 6.5349 | 6.5765 |
PLK1 | 13.3609 | 13.2284 | 13.2036 | 11.7141 | 11.0683 | 11.4187 |
MYLK | 6.001 | 6.0644 | 5.8142 | 4.8516 | 4.3028 | 4.2349 |
FGFR4 | 12.1166 | 11.4877 | 11.6853 | 6.6346 | 6.6259 | 8.9452 |
GSTM2 | 5.5849 | 5.3109 | 5.5775 | 4.1248 | 4.1039 | 4.2249 |
ICAM3 | 7.6834 | 7.4713 | 7.4442 | 5.0458 | 4.2768 | 4.5866 |
MCM3 | 12.629 | 12.264 | 12.5164 | 10.8958 | 10.9014 | 10.6858 |
BIRC5 | 14.0991 | 13.7906 | 13.8281 | 12.3395 | 11.9094 | 11.9143 |
CCNA2 | 11.8502 | 11.635 | 12.0767 | 9.4157 | 9.5595 | 8.8169 |
RPA1 | 12.0474 | 11.9014 | 12.0247 | 10.6035 | 10.7213 | 10.7478 |
LIG1 | 10.6459 | 10.3903 | 10.3169 | 6.8944 | 6.5974 | 6.436 |
BLCAP | 12.2036 | 12.0767 | 12.1286 | 10.4298 | 9.9584 | 9.8391 |
KIF2C | 11.5535 | 11.0646 | 11.2116 | 9.878 | 9.5702 | 9.5353 |
B4GAT1 | 12.4692 | 12.2328 | 12.8481 | 9.2592 | 8.9706 | 9.2705 |
CDK1 | 12.0924 | 11.6808 | 11.5027 | 9.5186 | 9.3677 | 8.8613 |
GNAI2 | 7.672 | 7.2853 | 7.7848 | 4.9956 | 5.7393 | 5.8153 |
PIP4K2B | 10.0748 | 9.2994 | 9.6079 | 7.915 | 7.3305 | 7.803 |
RPA2 | 10.7837 | 10.7144 | 10.6416 | 9.2743 | 9.4545 | 9.3044 |
BNIP3 | 13.1106 | 12.8928 | 13.1268 | 11.8215 | 11.8309 | 11.6011 |
MYBL2 | 11.1693 | 10.2445 | 10.8456 | 6.9978 | 7.9385 | 7.6942 |
CCDC85B | 9.2032 | 9.4712 | 8.9797 | 6.1097 | 6.4048 | 5.7463 |
DDB2 | 9.6507 | 9.9112 | 9.0347 | 7.0352 | 6.3435 | 6.8049 |
HADH | 10.8639 | 11.175 | 10.7867 | 6.9052 | 4.9005 | 7.535 |
STMN1 | 11.6776 | 11.6397 | 11.758 | 7.7854 | 7.5542 | 7.3276 |
PGM1 | 11.7042 | 11.6475 | 11.7823 | 10.2737 | 10.112 | 10.0544 |
NET1 | 11.1267 | 11.1003 | 11.0984 | 8.9472 | 9.2808 | 9.3391 |
PAFAH1B3 | 11.091 | 10.9963 | 11.0359 | 9.2592 | 8.8829 | 8.3493 |
G3BP1 | 10.01 | 10.1195 | 10.4165 | 7.1976 | 7.7548 | 7.486 |
CDCA4 | 10.5419 | 10.5697 | 10.2757 | 7.4051 | 6.9095 | 6.6141 |
NUSAP1 | 11.3012 | 11.5053 | 11.5573 | 9.5199 | 9.3345 | 9.201 |
PXMP2 | 10.5228 | 10.7553 | 10.6035 | 9.21 | 8.7501 | 9.379 |
CHEK2 | 10.3956 | 10.1351 | 11.0478 | 8.6892 | 8.282 | 8.5305 |
ADH5 | 12.6063 | 12.3957 | 12.799 | 11.4604 | 11.1425 | 11.2004 |
BPHL | 9.4545 | 9.8728 | 9.4614 | 6.3936 | 6.7395 | 6.5351 |
AMDHD2 | 11.518 | 11.6888 | 11.2862 | 7.4685 | 7.0048 | 6.5242 |
ACAT2 | 13.0273 | 13.0575 | 12.6895 | 9.7104 | 10.5323 | 10.891 |
PIN1 | 13.4289 | 13.6203 | 13.5245 | 11.8381 | 11.9252 | 12.2254 |
RPIA | 13.6124 | 13.5637 | 13.7667 | 12.13 | 12.1533 | 12.336 |
RFC2 | 9.5831 | 9.1262 | 9.5867 | 7.5818 | 7.7366 | 7.6309 |
ADI1 | 10.6008 | 10.1569 | 10.5471 | 8.595 | 9.0813 | 8.7241 |
TSPAN4 | 11.6947 | 11.5766 | 11.6165 | 10.4225 | 10.4225 | 10.1524 |
GPER1 | 8.8345 | 8.6832 | 8.9105 | 6.9438 | 6.8408 | 6.311 |
POLE2 | 9.1992 | 9.354 | 9.1659 | 7.7098 | 7.1747 | 6.9297 |
SLC37A4 | 7.4723 | 7.5992 | 7.8464 | 5.3106 | 4.9848 | 4.9522 |
DLGAP5 | 11.1854 | 11.2204 | 11.4665 | 9.0564 | 8.0154 | 8.4112 |
FAM162A | 11.862 | 12.217 | 11.634 | 9.49 | 8.6484 | 9.1588 |
CEP55 | 8.7246 | 8.4678 | 8.6213 | 6.8022 | 6.7255 | 6.7693 |
GLUL | 8.2339 | 8.3728 | 7.5773 | 2.436 | 2.4785 | 2.4758 |
CTSA | 14.1184 | 14.2757 | 13.8723 | 11.9074 | 12.1241 | 11.6858 |
SUMO3 | 11.4784 | 11.2471 | 10.7083 | 8.9665 | 8.7106 | 8.6236 |
NREP | 5.9582 | 5.0619 | 5.4411 | 2.8622 | 3.3497 | 3.3437 |
IFITM2 | 11.404 | 10.4542 | 11.079 | 8.0949 | 7.944 | 7.3063 |
GLB1 | 10.8754 | 10.0741 | 10.1972 | 7.8931 | 8.2681 | 8.0877 |
LANCL1 | 9.5877 | 9.6385 | 9.7125 | 7.594 | 7.6837 | 7.8063 |
FIBP | 9.4895 | 9.3126 | 9.1486 | 8.1551 | 8.0524 | 7.93 |
UNG | 11.5036 | 11.1843 | 11.4009 | 7.8877 | 9.122 | 8.8948 |
TK1 | 10.4321 | 10.1184 | 10.0709 | 8.0609 | 8.5518 | 8.5438 |
DHFR | 10.4664 | 10.2472 | 9.8291 | 8.3314 | 8.4714 | 8.1829 |
TOB1 | 10.6154 | 10.2518 | 10.6246 | 9.3173 | 8.7778 | 8.9518 |
RNASEH2A | 10.8449 | 10.8165 | 11.0484 | 9.2341 | 8.5076 | 8.0674 |
CYBA | 10.2508 | 10.3245 | 10.814 | 7.7657 | 7.9444 | 8.2122 |
SPAG5 | 10.7422 | 10.4247 | 10.1392 | 7.5051 | 8.2007 | 8.6508 |
TMPO | 11.8701 | 12.2098 | 12.0038 | 10.2086 | 10.6101 | 10.2938 |
SKP2 | 12.4847 | 12.2651 | 12.8774 | 9.1882 | 9.309 | 8.6171 |
NQO2 | 12.6012 | 12.5835 | 12.6715 | 10.8018 | 10.107 | 10.5723 |
VRK1 | 9.69 | 10.0131 | 9.9262 | 8.0925 | 8.4105 | 7.4701 |
TRIP13 | 10.8958 | 10.5905 | 10.8549 | 8.2813 | 8.632 | 7.8479 |
MYL6B | 13.2896 | 12.4928 | 12.7722 | 9.7541 | 10.3706 | 10.1138 |
GTSE1 | 10.1077 | 10.0505 | 9.4295 | 7.5789 | 7.6933 | 8.0003 |
POLA2 | 8.1332 | 7.7036 | 7.7435 | 6.3131 | 6.366 | 6.5471 |
KIF11 | 9.8715 | 9.6119 | 9.6627 | 7.0192 | 7.5923 | 8.0372 |
KIF23 | 8.9959 | 9.6438 | 9.3284 | 7.3311 | 7.416 | 7.804 |
SLC29A2 | 7.8075 | 8.1667 | 7.9098 | 6.7351 | 6.1519 | 6.2763 |
NUDT1 | 7.9406 | 7.2825 | 7.2738 | 5.6428 | 4.7771 | 5.1096 |
MGMT | 8.8103 | 8.7413 | 8.1023 | 7.0097 | 6.6135 | 6.817 |
SH3BGR | 5.351 | 5.3587 | 5.4567 | 4.2884 | 3.8609 | 4.0955 |
RAD51 | 9.1988 | 9.1843 | 8.9685 | 6.6172 | 7.5287 | 7.3383 |
PRIM1 | 8.6949 | 8.6695 | 8.5629 | 6.3125 | 7.1858 | 6.9828 |
CDC25C | 8.0584 | 8.5181 | 8.1908 | 6.7004 | 6.0956 | 6.1634 |
PEBP1 | 14.6275 | 14.0091 | 14.4593 | 12.4229 | 10.9822 | 11.5589 |
GAMT | 10.1787 | 9.5641 | 10.0587 | 7.2979 | 7.4866 | 6.7403 |
PDZK1 | 8.709 | 9.5169 | 8.4094 | 5.7755 | 4.3413 | 4.9732 |
SAC3D1 | 11.2538 | 11.1243 | 10.9388 | 9.124 | 9.4117 | 8.7279 |
SPINK2 | 7.5358 | 7.2241 | 7.1539 | 5.0674 | 5.7129 | 5.1188 |
CENPF | 9.2698 | 9.3747 | 8.9982 | 7.2837 | 6.8943 | 6.9705 |
CD164 | 13.2976 | 13.3573 | 13.6583 | 11.5844 | 11.9014 | 11.6786 |
C1S | 8.413 | 8.0745 | 8.7274 | 6.3209 | 5.5727 | 5.4185 |
XPO1 | 12.3803 | 12.4668 | 12.8043 | 10.2854 | 10.0889 | 10.6711 |
CCNG1 | 10.8796 | 10.2209 | 11.0008 | 7.4852 | 8.4553 | 8.2078 |
DUT | 11.5124 | 11.5901 | 11.661 | 9.4319 | 10.1324 | 9.1746 |
TUBB | 14.992 | 15 | 14.9161 | 12.8164 | 12.3702 | 12.5783 |
QDPR | 10.6681 | 11.3953 | 10.7478 | 8.1175 | 5.5802 | 6.7448 |
POLR2H | 10.8333 | 10.7406 | 10.7917 | 9.3057 | 9.1482 | 8.7386 |
AMACR | 8.2451 | 9.6518 | 8.3901 | 6.0492 | 5.0582 | 5.0598 |
LRP5 | 10.1568 | 10.4131 | 10.3772 | 8.8063 | 8.7768 | 9.1635 |
NSL1 | 10.1222 | 10.4291 | 10.3357 | 9.0494 | 8.9859 | 8.6062 |
PCYT2 | 11.3532 | 11.6288 | 11.4833 | 9.9118 | 9.4754 | 9.4193 |
BUB1 | 11.4331 | 11.2493 | 11.4241 | 9.479 | 9.6498 | 8.9904 |
TTR | 10.7176 | 11.5819 | 11.2478 | 8.9905 | 9.037 | 8.8896 |
SPC25 | 9.4867 | 10.0099 | 9.7114 | 6.8221 | 7.0503 | 7.6639 |
ABHD14A | 8.8253 | 8.9744 | 8.8984 | 6.9536 | 6.9997 | 7.1938 |
TPX2 | 13.6853 | 12.9548 | 13.9396 | 11.4122 | 10.8922 | 10.9818 |
BIN1 | 7.6346 | 7.4324 | 7.4185 | 5.8657 | 5.6004 | 5.3751 |
SIVA1 | 11.9252 | 11.2769 | 11.5073 | 9.8524 | 9.982 | 9.99 |
KHK | 9.1709 | 8.851 | 9.0307 | 7.5833 | 7.5166 | 7.1888 |
HSPA2 | 8.7599 | 9.1302 | 9.3364 | 5.7645 | 6.4444 | 5.68 |
ARL6IP1 | 12.7491 | 12.6222 | 13.0677 | 10.7531 | 11.3364 | 11.2645 |
MKI67 | 8.9045 | 8.3405 | 8.6669 | 7.1161 | 6.8476 | 6.8415 |
IFITM3 | 13.0015 | 13.6217 | 13.1064 | 9.0512 | 10.5813 | 8.9536 |
NME4 | 12.7569 | 12.6936 | 13.2481 | 8.8419 | 9.0598 | 8.8864 |
GTF2H5 | 11.5384 | 11.7594 | 11.4923 | 9.3448 | 9.2926 | 9.5333 |
ZBTB1 | 7.6214 | 8.1908 | 8.282 | 6.5741 | 6.5483 | 6.5064 |
CHN2 | 8.9066 | 9.3272 | 9.135 | 7.1786 | 7.432 | 7.4813 |
KAZN | 13.5963 | 13.4774 | 13.2565 | 10.4002 | 11.1773 | 10.2699 |
OIP5 | 10.0027 | 9.8755 | 9.7202 | 7.4558 | 7.668 | 7.8838 |
LGR5 | 11.1739 | 12.4906 | 12.6854 | 8.7314 | 9.2305 | 9.602 |
SRSF7 | 11.7789 | 11.2654 | 11.9074 | 9.9143 | 9.9348 | 9.5475 |
POLE | 9.4446 | 8.8655 | 8.5181 | 6.558 | 6.6705 | 7.0728 |
RBBP4 | 12.0683 | 12.2302 | 12.2927 | 10.8043 | 10.4713 | 10.7077 |
MTCH2 | 13.888 | 13.137 | 13.0545 | 11.0156 | 11.1582 | 11.5337 |
MRPL16 | 12.8401 | 13.1768 | 12.9182 | 10.8368 | 11.3922 | 11.4812 |
FKBP3 | 14.0733 | 13.2319 | 13.8646 | 11.7918 | 11.8823 | 11.9187 |
ECI2 | 14.6135 | 13.9475 | 14.3105 | 11.9209 | 10.4651 | 10.8428 |
ASF1B | 10.0544 | 10.0679 | 10.3827 | 7.5684 | 7.9973 | 7.3265 |
SPATA20 | 11.3942 | 11.2004 | 10.7057 | 9.4322 | 9.4326 | 9.5934 |
SLC25A10 | 9.3843 | 8.915 | 9.4712 | 7.7289 | 7.6087 | 7.7792 |
CARHSP1 | 11.753 | 12.7446 | 12.0145 | 10.0615 | 9.2019 | 8.8505 |
SNX10 | 9.2608 | 9.7502 | 9.8469 | 6.8862 | 6.7312 | 6.0068 |
KANK2 | 8.1908 | 8.5567 | 8.1203 | 6.5315 | 6.5293 | 6.0651 |
TMEM14A | 9.8342 | 9.5077 | 10.5964 | 6.1308 | 6.2754 | 6.8931 |
SNRNP25 | 13.2381 | 12.9277 | 12.9988 | 9.9387 | 9.8949 | 10.2714 |
SLC2A4RG | 10.284 | 10.4428 | 11.0999 | 8.3473 | 8.2992 | 8.3657 |
HILPDA | 8.2527 | 8.0968 | 8.2421 | 6.4789 | 6.7986 | 6.3793 |
MRS2 | 11.4647 | 11.5249 | 11.8336 | 10.019 | 10.017 | 10.013 |
FZD4 | 9.3704 | 8.9271 | 8.9521 | 7.6935 | 7.7768 | 7.4836 |
RAB29 | 8.7481 | 8.9797 | 9.0102 | 7.2115 | 7.4256 | 7.5368 |
PAAF1 | 8.5896 | 8.5745 | 8.0829 | 6.9845 | 6.7498 | 6.6609 |
MIS18A | 9.426 | 8.9757 | 8.9434 | 7.5351 | 7.7214 | 7.3493 |
GALNT11 | 9.1977 | 8.6707 | 8.8616 | 7.3867 | 7.208 | 6.9894 |
SIRT5 | 8.1216 | 8.5542 | 8.0975 | 6.4696 | 5.8064 | 6.0639 |
MACROD1 | 10.4447 | 10.2377 | 10.4641 | 8.4655 | 7.9754 | 8.4064 |
ELP5 | 11.71 | 12.13 | 11.9578 | 10.3056 | 10.2456 | 10.1368 |
APOA2 | 13.6536 | 13.7274 | 13.5063 | 12.1581 | 12.3022 | 11.6531 |
DECR2 | 8.7796 | 8.8573 | 8.6159 | 7.4847 | 6.9669 | 6.9551 |
E2F8 | 6.754 | 7.0127 | 7.03 | 4.2656 | 5.1844 | 5.0909 |
AUNIP | 7.6744 | 8.2741 | 8.3636 | 6.4296 | 6.5539 | 6.1956 |
RMND1 | 9.972 | 10.3148 | 10.2476 | 8.5507 | 8.2402 | 8.556 |
NELFCD | 12.0749 | 12.7741 | 12.5403 | 10.4685 | 10.7601 | 10.6224 |
OSGEPL1 | 6.9187 | 6.5264 | 6.9572 | 5.337 | 5.3283 | 5.0876 |
DNMT3B | 11.0698 | 10.5151 | 10.2101 | 8.5273 | 8.1624 | 8.3242 |
C1QTNF3 | 6.1157 | 6.5714 | 6.1375 | 3.7156 | 3.5055 | 3.8589 |
CDCA3 | 11.6475 | 12.4403 | 11.9435 | 9.4797 | 9.4267 | 9.4885 |
GINS2 | 11.1992 | 10.4443 | 10.6214 | 8.0706 | 8.8103 | 8.3134 |
CHPT1 | 13.2865 | 13.0761 | 12.9107 | 10.8333 | 10.3013 | 10.9499 |
SUB1 | 12.159 | 12.3968 | 12.0571 | 10.8202 | 10.9379 | 10.9545 |
GLRX5 | 11.2505 | 11.371 | 10.7061 | 8.6485 | 7.0541 | 8.5131 |
WRAP53 | 9.3659 | 9.1005 | 9.1154 | 7.9722 | 7.7244 | 8.006 |
HCFC1R1 | 9.7745 | 9.905 | 9.8847 | 8.3707 | 8.1695 | 8.0448 |
PAH | 8.9781 | 9.0819 | 8.761 | 7.2302 | 6.961 | 7.6162 |
MAT1A | 7.7415 | 7.4763 | 7.6342 | 6.5123 | 6.4125 | 6.4107 |
MYH3 | 7.7585 | 7.7717 | 7.8895 | 6.2055 | 6.3488 | 6.3369 |
LEFTY1 | 7.5301 | 7.2942 | 7.2807 | 5.213 | 5.6645 | 5.9721 |
F7 | 7.8468 | 7.5454 | 7.6078 | 6.2512 | 6.323 | 6.1342 |
The possible genes regulated by the transcription factor were obtained by calculation, and the results were displayed in the form of network
[1] SMARCA4-Deficient Thoracic Sarcoma: A Case Report and Review of Literature.
[2] [SMARCA4-deficient thoracic tumors: A new entity].
[3] SMARCA4 loss is synthetic lethal with CDK4/6 inhibition in non-small cell lung cancer.
[5] SMARCA4 mutations in KRAS-mutant lung adenocarcinoma: a multi-cohort analysis.
[8] Recurrent Loss of SMARCA4 in Sinonasal Teratocarcinosarcoma.
The KEGG pathway of the TF in this TRN is shown below
hsa04714