The possible genes regulated by the transcription factor were obtained by calculation, and the results were displayed in the form of network
In order to ensure the specificity of data, an ID index is built by the database itself, and each result corresponds to an ID.

| ID | BRD-K67860401 |
| name | AR-A014418 |
| type | Small molecule |
| molecular formula | C12H12N4O4S |
| molecular weight | 308.32 |
| condition dose | 10 uM |
| condition time | 6 h |
| smiles | COc1ccc(CNC(=O)Nc2ncc(s2)[N+]([O-])=O)cc1 |
Compound
Cell lines used for experiments
Transcription regulatory factors corresponding to this network
[1] GSK3β suppression inhibits MCL1 protein synthesis in human acute myeloid leukemia cells.
[2] N-(4-Meth-oxy-phen-yl)-N'-(5-nitro-1,3-thia-zol-2-yl)urea.
[4] GSK3α/β: A Novel Therapeutic Target for Neuroendocrine Tumors.
[9] Inhibition of GSK-3β on Behavioral Changes and Oxidative Stress in an Animal Model of Mania.
Protein target or gene target of this condition curated by previous studies and their associated KEGG pathways are shown below
| Target Gene | KEGG pathway |
|
GSK3B
|
hsa04910
|
| logfc | > 0.45 and P < = 1e-5. If you want to view or download the data, you can click [expand]
| Symbol | control | control | control | condition | condition | condition |
|---|---|---|---|---|---|---|
| ENTPD1 | 5.6672 | 6.9122 | 6.1539 | 4.2348 | 4.8687 | 4.3705 |
| L3MBTL1 | 7.3933 | 6.9927 | 7.1563 | 5.8957 | 5.629 | 5.6706 |
| CEP68 | 5.8121 | 5.403 | 5.5429 | 4.7306 | 3.9587 | 4.5599 |
| PCGF3 | 8.1267 | 8.4988 | 8.4002 | 6.7823 | 7.0694 | 6.9853 |
| CLEC16A | 7.1934 | 7.4244 | 7.656 | 6.6448 | 6.411 | 6.5712 |
| CBX7 | 5.4907 | 5.4716 | 4.9816 | 4.0791 | 4.2699 | 4.1495 |
| SALL2 | 9.4309 | 8.8108 | 8.9246 | 7.5234 | 7.5779 | 6.7133 |
| ZNF500 | 7.0651 | 7.1367 | 6.6973 | 6.0352 | 5.9447 | 6.2073 |
| METTL3 | 7.452 | 7.1466 | 7.304 | 4.9838 | 5.8837 | 5.7984 |
| GTF2H2B | 7.9209 | 6.8735 | 7.3188 | 5.6179 | 5.1656 | 5.1765 |
| ZSCAN32 | 6.8701 | 6.7343 | 6.6769 | 5.9371 | 6.023 | 5.465 |
| DCUN1D2 | 7.3422 | 7.4008 | 7.2572 | 6.3066 | 6.4899 | 6.6594 |
| ZNF232 | 10.2535 | 10.7334 | 10.4777 | 8.6873 | 9.013 | 8.3921 |
| TRMT13 | 7.1627 | 7.2921 | 7.1339 | 5.3515 | 5.4004 | 5.2522 |
| PTCD2 | 4.8213 | 4.6909 | 4.6754 | 4.0108 | 3.8541 | 4.0174 |
| CDADC1 | 6.0206 | 5.8876 | 6.1329 | 5.0676 | 5.1142 | 5.1744 |
| CSAD | 6.2691 | 6.3234 | 6.301 | 5.5703 | 4.8604 | 5.2537 |
| TARDBP | 9.3435 | 8.3995 | 9.3435 | 7.1789 | 6.5626 | 7.6146 |
| TBC1D12 | 8.079 | 7.7444 | 7.8911 | 6.8611 | 7.0863 | 7.1435 |
| NSUN6 | 5.998 | 6.1965 | 6.0287 | 5.0248 | 5.4243 | 5.1126 |
| DFFB | 6.6053 | 6.2494 | 6.6076 | 5.3252 | 5.4103 | 5.816 |
| PIK3R4 | 8.1497 | 8.039 | 8.0433 | 7.0442 | 6.972 | 6.4404 |
| AURKA | 8.2633 | 7.9615 | 7.8103 | 7.0945 | 7.0446 | 7.1551 |
| PIK3R3 | 5.3688 | 5.1069 | 4.9763 | 4.211 | 4.2163 | 4.335 |
| PLK1 | 13.5794 | 13.5088 | 13.5037 | 12.1459 | 12.4764 | 11.7076 |
| APPBP2 | 8.2633 | 8.3146 | 8.5119 | 7.2922 | 6.6546 | 6.5055 |
| EFCAB14 | 8.3643 | 8.5724 | 8.2808 | 7.176 | 7.0358 | 7.4601 |
| TXLNA | 14.0164 | 13.8117 | 13.8972 | 12.4327 | 12.5635 | 13.1613 |
| TRAK2 | 7.4489 | 7.0685 | 7.3426 | 5.3252 | 5.1086 | 5.5488 |
| BUB1B | 11.4196 | 11.6506 | 11.4249 | 10.3314 | 10.2759 | 9.9426 |
| ENOSF1 | 6.7545 | 6.5081 | 6.8597 | 5.9433 | 5.4265 | 5.5792 |
| PAFAH1B1 | 9.3655 | 9.4434 | 9.5555 | 8.3026 | 7.701 | 7.6881 |
| PSRC1 | 10.3531 | 10.1141 | 10.2785 | 7.6701 | 8.8973 | 7.5543 |
| NUP62 | 10.4608 | 10.3723 | 9.9371 | 9.0324 | 8.831 | 7.8802 |
| KIF2C | 12.0565 | 11.6616 | 11.6349 | 10.3867 | 10.3512 | 10.2313 |
| PIP4K2B | 9.5397 | 10.1717 | 9.6299 | 8.3691 | 8.1699 | 7.0181 |
| STMN1 | 12.4135 | 11.6079 | 11.9419 | 10.8542 | 10.8752 | 10.6805 |
| TSEN2 | 8.8132 | 8.1837 | 7.8625 | 6.8689 | 6.4303 | 6.3229 |
| IKBKE | 6.0788 | 5.9279 | 6.1668 | 4.9549 | 5.3321 | 5.2599 |
| NUSAP1 | 12.2065 | 11.9569 | 12.0959 | 10.9416 | 10.7421 | 10.4821 |
| GPATCH8 | 7.9299 | 8.4115 | 8.4426 | 6.7846 | 6.6706 | 6.7283 |
| EIF5 | 13.1079 | 12.9232 | 12.9708 | 11.0175 | 10.7831 | 10.9772 |
| LSR | 11.6357 | 11.7672 | 11.7066 | 9.8405 | 10.0147 | 9.8883 |
| ZNF589 | 6.9667 | 6.9777 | 7.2123 | 5.0855 | 5.463 | 5.8916 |
| ZDHHC6 | 9.4408 | 9.3094 | 9.5371 | 8.173 | 8.2612 | 7.7071 |
| THAP11 | 9.399 | 9.0412 | 9.2426 | 8.4012 | 8.1002 | 8.3743 |
| PARP2 | 11.5944 | 11.575 | 11.6142 | 8.0106 | 8.5137 | 7.7339 |
| KIAA0753 | 7.9452 | 7.5905 | 7.8914 | 6.5372 | 6.5708 | 6.22 |
| ABHD6 | 7.5774 | 7.2399 | 7.3505 | 6.4831 | 6.1424 | 6.1897 |
| RPP38 | 8.0019 | 8.0524 | 7.9661 | 7.2483 | 7.0766 | 7.388 |
| CCNF | 8.8427 | 8.7456 | 8.2679 | 6.3129 | 6.4098 | 6.6895 |
| ZC3H4 | 8.8132 | 8.9314 | 8.5306 | 7.5076 | 7.4322 | 7.9063 |
| FZD5 | 13.0735 | 13.101 | 12.5728 | 11.3088 | 11.3249 | 10.9877 |
| DDX1 | 13.0746 | 13.5037 | 13.0691 | 12.4699 | 12.0559 | 12.0204 |
| CUL4A | 11.1016 | 11.4782 | 10.6883 | 9.8553 | 10.0658 | 9.9451 |
| TIA1 | 10.3036 | 11.1386 | 10.2322 | 8.6908 | 9.1703 | 8.7277 |
| ZFR | 11.3257 | 10.9377 | 11.3179 | 10.2796 | 9.9868 | 10.3981 |
| PPP2R5C | 8.5476 | 8.3071 | 8.1209 | 7.176 | 6.5907 | 7.055 |
| RRM2 | 14.0484 | 13.7602 | 13.2578 | 11.9517 | 11.9414 | 12.4376 |
| ZMYM4 | 9.6401 | 9.0392 | 9.7343 | 8.5156 | 8.2444 | 7.9187 |
| SEL1L | 10.661 | 10.5531 | 10.2358 | 9.6975 | 9.2394 | 8.9051 |
| MTX2 | 12.3182 | 12.1411 | 12.4227 | 11.3367 | 11.2791 | 11.4021 |
| SKP2 | 12.025 | 12.374 | 12.401 | 10.8157 | 10.3971 | 11.4324 |
| CSTF3 | 9.3569 | 9.4149 | 9.3943 | 8.4711 | 8.323 | 7.8601 |
| MEIS1 | 8.2434 | 8.4408 | 7.8346 | 5.9905 | 5.9097 | 5.2674 |
| RFC3 | 12.9635 | 12.3663 | 13.0859 | 11.5689 | 11.2391 | 11.6349 |
| COL7A1 | 6.6154 | 6.8157 | 6.667 | 5.1993 | 5.0297 | 5.9846 |
| EFNA4 | 9.2193 | 9.1197 | 8.981 | 8.2757 | 8.469 | 8.2928 |
| BARD1 | 8.0866 | 8.0573 | 8.0261 | 7.3358 | 6.835 | 6.7225 |
| MLLT10 | 7.7122 | 8.2685 | 8.389 | 7.0419 | 7.1901 | 6.6788 |
| GEMIN4 | 10.0845 | 10.026 | 10.3314 | 8.9449 | 9.265 | 9.2916 |
| OGG1 | 9.1677 | 9.2406 | 9.1031 | 8.5213 | 8.1591 | 8.2788 |
| GINS1 | 12.7717 | 12.6827 | 12.8668 | 11.2765 | 10.9861 | 10.9914 |
| SLC16A5 | 5.7177 | 5.2457 | 5.7864 | 4.5925 | 4.6218 | 4.4587 |
| LETMD1 | 9.9177 | 10.0359 | 9.7812 | 8.902 | 8.7818 | 8.7698 |
| EXOSC10 | 12.0825 | 12.3311 | 12.3876 | 11.577 | 11.4978 | 11.4401 |
| XPO1 | 12.0511 | 12.2385 | 11.9158 | 11.3483 | 11.2832 | 11.1701 |
| NCOA6 | 9.3312 | 9.5641 | 9.5463 | 8.6044 | 8.6121 | 8.3867 |
| CLN3 | 8.7692 | 8.6858 | 8.7101 | 7.8421 | 7.6396 | 7.8456 |
| BCL2L2 | 11.3692 | 11.1639 | 11.5066 | 10.3747 | 10.5578 | 9.9058 |
| NSL1 | 10.2031 | 9.6645 | 9.9149 | 9.1381 | 8.9044 | 8.9306 |
| EXTL2 | 9.4164 | 10.069 | 9.824 | 8.1221 | 8.6978 | 7.6089 |
| DCLRE1A | 6.6943 | 6.2584 | 6.481 | 5.4101 | 5.2797 | 5.7519 |
| CCNO | 4.9528 | 5.0274 | 5.3999 | 4.1158 | 3.9183 | 3.7721 |
| APEX1 | 15 | 15 | 15 | 13.4108 | 13.763 | 13.359 |
| CROCCP2 | 10.2338 | 9.5821 | 10.1911 | 8.8487 | 8.7771 | 8.6502 |
| CBX5 | 9.3692 | 9.4813 | 9.3977 | 8.0782 | 7.7162 | 7.9053 |
| MRPS31 | 11.6605 | 11.0702 | 11.4933 | 10.4524 | 10.3938 | 10.2036 |
| TBC1D2B | 7.103 | 7.1887 | 7.1238 | 6.1304 | 6.3492 | 6.3123 |
| NFATC2IP | 9.6177 | 9.1128 | 9.1474 | 8.499 | 8.2746 | 8.0696 |
| DICER1 | 8.8983 | 9.6394 | 9.5118 | 7.9083 | 8.0317 | 8.1849 |
| ANKRD28 | 4.3536 | 4.7556 | 4.2398 | 3.503 | 3.426 | 3.2218 |
| RALGAPA1 | 10.2603 | 10.0289 | 10.1378 | 8.7637 | 8.4028 | 8.877 |
| EDRF1 | 8.151 | 7.6823 | 8.5469 | 5.22 | 5.6194 | 5.7661 |
| CBR4 | 9.1383 | 8.8897 | 8.167 | 7.2049 | 6.8515 | 7.5341 |
| PMS1 | 8.4124 | 8.7485 | 8.9951 | 7.319 | 6.4 | 6.708 |
| UPF3A | 10.6082 | 9.9555 | 9.9099 | 8.5945 | 9.1131 | 8.3838 |
| ZNF337 | 7.462 | 7.0297 | 7.2183 | 6.1265 | 6.1864 | 6.2337 |
| SLC7A8 | 6.2231 | 6.483 | 6.3975 | 5.3143 | 5.2786 | 4.7434 |
| SLC35E2B | 6.8235 | 6.1532 | 6.6187 | 5.229 | 4.6638 | 5.2646 |
| EPS15 | 7.2174 | 7.7339 | 7.6817 | 5.9171 | 5.4911 | 6.1779 |
| FKBP3 | 13.6066 | 13.8257 | 13.7544 | 12.018 | 12.3212 | 12.2198 |
| PRPF38B | 7.9136 | 8.0752 | 7.9003 | 7.0158 | 6.8479 | 7.351 |
| ARGLU1 | 10.164 | 9.7397 | 9.6979 | 8.6408 | 8.5502 | 8.8206 |
| METTL17 | 14.0277 | 13.6994 | 13.687 | 12.4891 | 12.0711 | 12.254 |
| S100PBP | 7.4792 | 7.6247 | 7.2165 | 6.2353 | 6.2406 | 5.6384 |
| RBM26 | 12.0541 | 11.4466 | 11.3124 | 10.4621 | 10.4666 | 10.263 |
| BBS1 | 6.8088 | 6.4707 | 7.2982 | 5.8592 | 5.5728 | 5.5587 |
| SMG8 | 9.0108 | 9.1255 | 9.1933 | 8.4547 | 7.9066 | 8.2111 |
| PCTP | 9.1808 | 9.5904 | 9.8253 | 8.1305 | 8.4659 | 8.3117 |
| NCKIPSD | 7.8646 | 7.9497 | 7.652 | 6.7103 | 6.9265 | 7.1622 |
| RNF111 | 7.0213 | 6.4975 | 7.0082 | 5.9752 | 5.9168 | 5.7025 |
| NUP107 | 12.0033 | 12.3528 | 11.7162 | 10.9812 | 11.0529 | 10.9396 |
| FASTKD1 | 8.8241 | 9.0437 | 9.2022 | 8.2928 | 7.8462 | 7.782 |
| C2orf42 | 6.8527 | 6.6202 | 6.8969 | 5.8033 | 5.5244 | 5.4123 |
| MFF | 10.2383 | 10.1329 | 10.122 | 8.9833 | 8.3962 | 8.607 |
| DNAAF2 | 9.1176 | 9.1313 | 9.1914 | 8.345 | 8.2566 | 8.5438 |
| RIC8B | 5.4903 | 6.0589 | 5.655 | 4.6765 | 4.7771 | 4.7738 |
| BORA | 9.0232 | 9.0727 | 9.0371 | 8.0531 | 8.1559 | 7.885 |
| ALG6 | 9.9493 | 9.83 | 10.5553 | 8.7269 | 8.493 | 8.4517 |
| NARF | 11.0964 | 11.0255 | 11.017 | 10.3619 | 10.1069 | 10.2944 |
| ZFYVE21 | 7.4762 | 7.743 | 7.6377 | 6.5774 | 6.8611 | 6.676 |
| HELLS | 7.9748 | 7.7105 | 7.9323 | 6.5226 | 6.687 | 6.3583 |
| ENGASE | 8.2084 | 8.1305 | 8.4115 | 7.0378 | 6.8569 | 7.049 |
| C1QTNF3 | 5.0113 | 4.666 | 4.8139 | 2.7971 | 3.6614 | 3.2197 |
| TRMT1L | 7.2226 | 6.8926 | 6.737 | 5.7345 | 5.5597 | 6.0376 |
| MSANTD2 | 7.9958 | 8.1209 | 7.9937 | 6.6462 | 6.396 | 6.3063 |
| MPHOSPH8 | 7.1248 | 7.4495 | 7.1136 | 5.9678 | 6.1392 | 5.7641 |
| SYNRG | 7.7835 | 8.2145 | 8.3606 | 6.2298 | 7.1287 | 5.7612 |
| ZNF45 | 6.9248 | 7.1333 | 7.3148 | 6.0632 | 5.9276 | 5.989 |
| IL1R1 | 6.2112 | 6.535 | 6.5129 | 4.1227 | 4.3521 | 4.9581 |
| FAN1 | 6.3098 | 5.7721 | 6.0455 | 4.8679 | 4.4429 | 4.1341 |
| FRY | 5.5217 | 5.0006 | 4.9182 | 3.7877 | 4.0206 | 4.066 |
| CARD8 | 5.3967 | 4.8215 | 5.6734 | 3.9556 | 3.3054 | 3.7684 |
The possible genes regulated by the transcription factor were obtained by calculation, and the results were displayed in the form of network
[1] KLF10 as a Tumor Suppressor Gene and Its TGF-beta Signaling.
[2] A KDM6A-KLF10 reinforcing feedback mechanism aggravates diabetic podocyte dysfunction.
[3] KLF10 Deficiency in CD4(+) T Cells Triggers Obesity, Insulin Resistance, and Fatty Liver.
[4] KLF10 is a modulatory factor of chondrocyte hypertrophy in developing skeleton.
[6] KLF10 Gene Expression Modulates Fibrosis in Dystrophic Skeletal Muscle.
[8] KLF10 transcription factor regulates hepatic glucose metabolism in mice.
[9] Deletion of KLF10 Leads to Stress-Induced Liver Fibrosis upon High Sucrose Feeding.
[10] FBW7 targets KLF10 for ubiquitin-dependent degradation.
The KEGG pathway of the TF in this TRN is shown below