The possible genes regulated by the transcription factor were obtained by calculation, and the results were displayed in the form of network
In order to ensure the specificity of data, an ID index is built by the database itself, and each result corresponds to an ID.

| ID | BRD-K75308783 |
| name | SAR-245409 |
| type | Small molecule |
| molecular formula | NA |
| molecular weight | NA |
| condition dose | 10.0 um |
| condition time | 24 h |
| smiles | COc1cc(Nc2nc3ccccc3nc2NS(=O)(=O)c2ccc(NC(=O)c3ccc(C)c(OC)c3)cc2)cc(OC)c1 |
Compound
Cell lines used for experiments
Transcription regulatory factors corresponding to this network
Protein target or gene target of this condition curated by previous studies and their associated KEGG pathways are shown below
| Target Gene | KEGG pathway |
|
MTOR
|
hsa04930
|
|
PIK3CG
|
hsa00562
|
| logfc | > 0.45 and P < = 1e-5. If you want to view or download the data, you can click [expand]
| Symbol | control | control | control | condition | condition | condition |
|---|---|---|---|---|---|---|
| CDC42SE1 | 8.5508 | 8.8608 | 9.112 | 9.5271 | 9.7546 | 9.9551 |
| SPATA20 | 8.3253 | 7.8744 | 8.758 | 9.5989 | 9.8437 | 9.9571 |
| RAB25 | 8.0091 | 8.7742 | 8.1365 | 9.0566 | 9.3286 | 9.2085 |
| TSKU | 6.5659 | 7.1666 | 6.929 | 7.7946 | 7.619 | 7.8414 |
| AP1M2 | 10.2871 | 10.6546 | 10.413 | 11.3583 | 11.6706 | 11.0405 |
| ZC3H7A | 8.0717 | 8.1906 | 8.0972 | 8.7513 | 8.9281 | 8.7317 |
| HEBP1 | 8.1035 | 7.7447 | 10.137 | 10.1129 | 10.3274 | 10.3566 |
| DPP3 | 9.8758 | 10.0621 | 10.3185 | 10.4864 | 10.8641 | 11.3103 |
| S100A14 | 9.9353 | 10.9667 | 10.9255 | 11.9211 | 12.0202 | 11.1897 |
| C14orf132 | 9.9992 | 10.0492 | 10.1914 | 10.9074 | 10.8808 | 11.4843 |
| SPRR3 | 2.2691 | 2.8284 | 2.5616 | 3.3789 | 4.4927 | 3.8719 |
| RHOF | 3.5391 | 3.486 | 4.7928 | 5.0734 | 4.8679 | 5.2511 |
| AMDHD2 | 9.0555 | 8.5536 | 9.2937 | 9.2075 | 11.5083 | 11.7018 |
| OGDHL | 5.6196 | 5.051 | 5.94 | 7.1312 | 6.2879 | 6.3284 |
| ESRP2 | 7.9692 | 7.9345 | 8.5667 | 9.4905 | 8.9979 | 8.6846 |
| ACSS3 | 5.326 | 5.5356 | 5.3636 | 6.2005 | 7.1761 | 7.0873 |
| GALNT6 | 9.5325 | 9.2649 | 9.6356 | 10.3676 | 10.8101 | 10.9077 |
| BCAS3 | 10.6817 | 10.1819 | 12.466 | 12.6944 | 12.8328 | 13.0647 |
| PER3 | 5.5198 | 5.3984 | 5.0686 | 6.329 | 5.8065 | 6.1642 |
| HSPB8 | 6.4964 | 6.6408 | 9.1828 | 10.8674 | 9.0337 | 9.2454 |
| CHPT1 | 7.7053 | 7.706 | 7.8469 | 8.5023 | 8.4449 | 8.7603 |
| DDX5 | 10.7641 | 10.4706 | 10.7562 | 12.0473 | 12.2603 | 11.3078 |
| HNRNPM | 10.1476 | 10.1126 | 10.0169 | 10.4902 | 10.7452 | 11.1142 |
| COX4I1 | 11.5466 | 11.8301 | 12.0705 | 12.7934 | 13.1753 | 12.2125 |
| HSP90B1 | 10.0047 | 9.5677 | 10.4477 | 11.2863 | 10.9746 | 10.7763 |
| LASP1 | 7.4129 | 7.5141 | 8.0012 | 8.3512 | 8.5044 | 8.6302 |
| PRKCSH | 10.633 | 10.0113 | 11.0361 | 11.5253 | 11.5235 | 11.7547 |
| IQGAP1 | 7.8994 | 8.2667 | 7.9526 | 8.5351 | 8.7865 | 8.7615 |
| TMBIM6 | 11.5277 | 11.8399 | 12.0396 | 12.3497 | 13.4507 | 13.0163 |
| MLF2 | 12.0619 | 12.2137 | 12.619 | 12.9906 | 13.6433 | 12.8542 |
| ALDOA | 6.8893 | 6.5004 | 6.3357 | 7.1412 | 9.3616 | 10.3127 |
| PPT1 | 10.5423 | 11.0525 | 10.7206 | 11.3481 | 12.89 | 12.2273 |
| CDH1 | 8.0432 | 7.9082 | 9.5543 | 11.7322 | 11.3055 | 10.9836 |
| ARCN1 | 8.0408 | 7.5157 | 8.035 | 8.5487 | 8.8301 | 8.4785 |
| ERP29 | 10.7083 | 11.0075 | 11.0437 | 11.4284 | 11.8722 | 11.7085 |
| CDIPT | 9.5151 | 9.7253 | 10.0414 | 10.5925 | 10.2244 | 10.5575 |
| ARHGEF12 | 3.525 | 4.0449 | 3.683 | 4.7066 | 5.01 | 4.4208 |
| NQO1 | 12.3831 | 11.473 | 13.1411 | 13.5931 | 13.9411 | 13.1948 |
| PPIF | 8.8308 | 8.2908 | 9.2679 | 9.6276 | 9.7617 | 9.4772 |
| CBX1 | 9.8929 | 9.9834 | 10.7761 | 11.187 | 11.1573 | 11.1216 |
| UBL3 | 5.4518 | 5.7122 | 5.7369 | 6.8304 | 6.9635 | 6.5769 |
| KDM5B | 6.8829 | 6.8216 | 6.7195 | 8.0835 | 7.7014 | 7.5992 |
| PPP1R12A | 6.9567 | 6.8816 | 7.387 | 7.9919 | 7.8337 | 8.005 |
| DDX42 | 7.8226 | 7.1347 | 7.7251 | 8.4836 | 8.2956 | 8.6198 |
| NET1 | 8.7797 | 8.6989 | 8.781 | 9.5478 | 9.7779 | 9.804 |
| GOLGA3 | 7.4411 | 7.9722 | 7.6883 | 8.6367 | 8.2816 | 8.2713 |
| TACSTD2 | 11.083 | 10.5056 | 11.3674 | 13.1244 | 13.4996 | 12.3131 |
| CBFB | 8.6919 | 8.8663 | 9.4055 | 9.7525 | 10.0652 | 10.2025 |
| IFI27 | 4.6334 | 4.8585 | 5.9057 | 5.5874 | 6.849 | 6.866 |
| TNFAIP2 | 3.6133 | 3.2917 | 2.5797 | 3.7398 | 5.529 | 5.0122 |
| APPBP2 | 10.1101 | 9.835 | 10.3236 | 13.1352 | 13.8935 | 10.6799 |
| TOB1 | 9.524 | 8.3254 | 9.5179 | 10.7429 | 12.47 | 10.1967 |
| PIEZO1 | 11.521 | 11.0748 | 10.8261 | 12.0166 | 12.0363 | 11.9306 |
| SLC37A4 | 5.2339 | 5.0839 | 6.5069 | 6.877 | 6.8729 | 7.2841 |
| NDUFS8 | 10.0831 | 9.948 | 11.0967 | 11.1558 | 11.4756 | 11.3365 |
| CLK2 | 7.9919 | 8.0612 | 8.2851 | 8.8581 | 8.9076 | 8.6677 |
| IGF1R | 9.1293 | 8.9047 | 9.4097 | 9.867 | 9.8263 | 9.8291 |
| TDG | 9.6158 | 9.4449 | 10.2451 | 10.9818 | 11.0974 | 11.2217 |
| RPS6KB2 | 7.8106 | 7.9734 | 8.2766 | 8.4116 | 9.6321 | 9.024 |
| LUC7L3 | 9.1636 | 9.8718 | 9.9391 | 11.5071 | 11.5701 | 10.0836 |
| GAB2 | 8.1891 | 8.2314 | 8.7292 | 9.3664 | 8.9052 | 9.0509 |
| MARK2 | 5.9943 | 5.7578 | 6.122 | 6.5916 | 6.8064 | 7.0338 |
| ENOSF1 | 5.5328 | 5.1749 | 5.73 | 6.5921 | 6.2097 | 6.2761 |
| NPIPA1 | 7.6095 | 8.1607 | 8.1441 | 9.4464 | 9.6342 | 8.8776 |
| CCDC85B | 8.2612 | 7.8218 | 8.5211 | 9.0667 | 9.2516 | 8.8396 |
| CLPX | 8.2692 | 7.9265 | 8.7462 | 8.8919 | 10.5041 | 10.167 |
| ALDH3B2 | 6.0319 | 5.574 | 5.383 | 6.6217 | 7.1801 | 7.0231 |
| P2RY2 | 6.2836 | 6.7408 | 6.5073 | 7.0551 | 7.4028 | 7.1689 |
| PRB3 | 3.7062 | 3.3986 | 3.781 | 4.3676 | 4.8828 | 4.0592 |
| TNFRSF1A | 9.0614 | 9.4184 | 10.6148 | 10.573 | 11.6846 | 10.9351 |
| PTP4A2 | 8.1288 | 7.8161 | 8.1533 | 8.7573 | 8.831 | 9.4638 |
| VAT1 | 9.32 | 8.8642 | 9.538 | 10.3668 | 10.1274 | 10.2602 |
| PRDX1 | 9.3902 | 9.8851 | 9.6059 | 10.6914 | 10.9172 | 10.517 |
| OXA1L | 11.1811 | 11.1422 | 12.6883 | 12.6612 | 13.2678 | 13.0298 |
| LGALS3 | 12.5087 | 12.0303 | 13.1934 | 13.2126 | 14.0805 | 13.6723 |
| KDM2A | 6.5546 | 6.3653 | 6.7031 | 7.2875 | 7.4628 | 7.2731 |
| COMMD4 | 8.1805 | 8.0807 | 9.0087 | 9.1121 | 9.6891 | 9.7763 |
| CYB561 | 9.9851 | 9.9463 | 10.7397 | 11.2908 | 11.3975 | 11.2372 |
| KIF2C | 4.5413 | 3.774 | 3.828 | 5.2645 | 5.4751 | 5.1192 |
| BTAF1 | 5.8194 | 6.2354 | 6.1105 | 6.9344 | 6.9026 | 6.7518 |
| IRX5 | 3.9846 | 2.7152 | 4.3522 | 5.6763 | 5.0972 | 5.0501 |
| JTB | 10.4039 | 10.3607 | 10.5078 | 11.5079 | 11.0441 | 11.2819 |
| TAGLN2 | 11.0158 | 11.2803 | 10.6941 | 11.6185 | 11.7605 | 11.8398 |
| CROCCP2 | 6.7178 | 7.3814 | 6.8674 | 8.3862 | 8.0659 | 7.4554 |
| RET | 7.6614 | 7.6477 | 9.6276 | 9.8856 | 10.0353 | 10.0428 |
| ANXA9 | 6.4746 | 6.6943 | 6.5941 | 7.2298 | 7.9818 | 7.1477 |
| EIF4A1 | 12.8759 | 12.4764 | 13.2798 | 13.4278 | 13.8966 | 13.6653 |
| PRRC2C | 9.8612 | 9.1908 | 9.1205 | 10.4548 | 10.6708 | 9.9338 |
| ATXN7L3B | 10.6545 | 10.2107 | 10.2871 | 10.9478 | 11.351 | 11.4958 |
| MED13L | 6.2465 | 5.9774 | 6.8487 | 7.1508 | 7.4084 | 7.0766 |
| SLC7A1 | 9.8519 | 8.9475 | 9.1296 | 10.4355 | 10.1421 | 10.7984 |
| ELF1 | 7.2738 | 6.5367 | 7.1891 | 8.1039 | 8.3684 | 8.1658 |
| PTPN11 | 8.6342 | 9.1853 | 9.036 | 10.1307 | 10.4757 | 9.9901 |
| MSL1 | 6.207 | 6.0201 | 7.0542 | 6.9959 | 8.0718 | 7.8469 |
| TRIM37 | 11.8735 | 11.7306 | 13.5374 | 13.7259 | 13.8386 | 14.0658 |
| SETD1B | 4.8077 | 4.5565 | 5.4872 | 6.0226 | 6.181 | 6.2015 |
| APRT | 11.4774 | 11.1417 | 12.5317 | 12.5532 | 12.9007 | 13.0166 |
| GAL | 8.5146 | 9.6129 | 7.98 | 10.2773 | 9.8285 | 10.3514 |
| SPATA2L | 7.4682 | 7.2025 | 7.6578 | 7.9867 | 8.7552 | 8.3531 |
| ERBB2 | 7.8861 | 8.3525 | 8.4379 | 9.3018 | 9.2089 | 9.1424 |
| SFXN3 | 6.2593 | 6.2457 | 6.6795 | 7.6275 | 7.1499 | 7.0562 |
| OSBPL9 | 6.2506 | 6.0917 | 6.3916 | 7.3055 | 6.6538 | 7.0977 |
| ARGLU1 | 8.0272 | 7.7334 | 8.3829 | 9.3901 | 8.9199 | 8.551 |
The possible genes regulated by the transcription factor were obtained by calculation, and the results were displayed in the form of network
[3] The Role of Early Growth Response 1 (EGR1) in Brain Plasticity and Neuropsychiatric Disorders.
[4] Egr1 mediates retinal vascular dysfunction in diabetes mellitus via promoting p53 transcription.
[5] EGR1 interacts with TBX2 and functions as a tumor suppressor in rhabdomyosarcoma.
[6] Egr1 mediates the effect of insulin on leptin transcription in adipocytes.
[8] Role of PAR1-Egr1 in the Initiation of Thoracic Aortic Aneurysm in Fbln4-Deficient Mice.
The KEGG pathway of the TF in this TRN is shown below